About tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane
tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane (PubChem CID 15691228) has the molecular formula C15H30OSi
and a molecular weight of 254.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane |
| PubChem CID | 15691228 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane |
| SMILES | C=CCC(C)/C=C(\CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-9-11-13(3)12-14(10-2)16-17(7,8)15(4,5)6/h9,12-13H,1,10-11H2,2-8H3/b14-12+ |
| InChIKey | JFEKWEGJLFBGMQ-WYMLVPIESA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane?
The IUPAC name of tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane (CID 15691228) is tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane?
The canonical SMILES for tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane is C=CCC(C)/C=C(\CC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane?
The InChIKey is JFEKWEGJLFBGMQ-WYMLVPIESA-N. The full InChI is InChI=1S/C15H30OSi/c1-9-11-13(3)12-14(10-2)16-17(7,8)15(4,5)6/h9,12-13H,1,10-11H2,2-8H3/b14-12+.
What are the key properties of tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane?
tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane has a molecular weight of 254.49 g/mol, XLogP of 5.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(3E)-5-methylocta-3,7-dien-3-yl]oxysilane is sourced from PubChem (CID 15691228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).