C11H23IO2Si — CID 172738492
(E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-iodopent-1-en-3-ol (PubChem CID 172738492) has the molecular formula C11H23IO2Si and a molecular weight of 342.29 g/mol. Its IUPAC name is (E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-iodopent-1-en-3-ol.
| Compound Name | (E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-iodopent-1-en-3-ol |
|---|---|
| PubChem CID | 172738492 |
| Molecular Formula | C11H23IO2Si |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-iodopent-1-en-3-ol |
| SMILES | CC[C@@H](O)/C=C(/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H23IO2Si/c1-7-9(13)8-10(12)14-15(5,6)11(2,3)4/h8-9,13H,7H2,1-6H3/b10-8-/t9-/m1/s1 |
| InChIKey | ITQWZXFFDGPTBG-URLRMUCDSA-N |
| XLogP | 4.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|