C14H30O3Si — CID 10707504
(Z,2S,6R)-1-[tert-butyl(dimethyl)silyl]oxyoct-3-ene-2,6-diol (PubChem CID 10707504) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is (Z,2S,6R)-1-[tert-butyl(dimethyl)silyl]oxyoct-3-ene-2,6-diol.
| Compound Name | (Z,2S,6R)-1-[tert-butyl(dimethyl)silyl]oxyoct-3-ene-2,6-diol |
|---|---|
| PubChem CID | 10707504 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (Z,2S,6R)-1-[tert-butyl(dimethyl)silyl]oxyoct-3-ene-2,6-diol |
| SMILES | CC[C@@H](O)C/C=C\[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-7-12(15)9-8-10-13(16)11-17-18(5,6)14(2,3)4/h8,10,12-13,15-16H,7,9,11H2,1-6H3/b10-8-/t12-,13+/m1/s1 |
| InChIKey | KAKPOCMRQAFCAE-JPYZIQITSA-N |
| XLogP | 3.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|