C14H28O3Si — CID 10540140
(2S,3Z,6S)-1-[tert-butyl(dimethyl)silyl]oxyocta-3,7-diene-2,6-diol (PubChem CID 10540140) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (2S,3Z,6S)-1-[tert-butyl(dimethyl)silyl]oxyocta-3,7-diene-2,6-diol.
| Compound Name | (2S,3Z,6S)-1-[tert-butyl(dimethyl)silyl]oxyocta-3,7-diene-2,6-diol |
|---|---|
| PubChem CID | 10540140 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2S,3Z,6S)-1-[tert-butyl(dimethyl)silyl]oxyocta-3,7-diene-2,6-diol |
| SMILES | C=C[C@@H](O)C/C=C\[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-7-12(15)9-8-10-13(16)11-17-18(5,6)14(2,3)4/h7-8,10,12-13,15-16H,1,9,11H2,2-6H3/b10-8-/t12-,13+/m1/s1 |
| InChIKey | MYKGIXWPSKZAAL-JPYZIQITSA-N |
| XLogP | 2.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|