C11H23Cl3O2SiSn — CID 10646755
(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-trichlorostannylpent-3-en-2-ol (PubChem CID 10646755) has the molecular formula C11H23Cl3O2SiSn and a molecular weight of 440.46 g/mol. Its IUPAC name is (E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-trichlorostannylpent-3-en-2-ol.
| Compound Name | (E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-trichlorostannylpent-3-en-2-ol |
|---|---|
| PubChem CID | 10646755 |
| Molecular Formula | C11H23Cl3O2SiSn |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | (E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-trichlorostannylpent-3-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)/C=C/C[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/C11H23O2Si.3ClH.Sn/c1-7-8-10(12)9-13-14(5,6)11(2,3)4;;;;/h7-8,10,12H,1,9H2,2-6H3;3*1H;/q;;;;+3/p-3/b8-7+;;;;/t10-;;;;/m0..../s1 |
| InChIKey | QFETUVGXSCNVQL-QVJNFKDISA-K |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|