C16H34O2Si — CID 91552534
6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyloct-2-en-4-ol (PubChem CID 91552534) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyloct-2-en-4-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyloct-2-en-4-ol |
|---|---|
| PubChem CID | 91552534 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyloct-2-en-4-ol |
| SMILES | CC=CC(O)C(C)(C)C(CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-10-12-13(17)16(6,7)14(11-2)18-19(8,9)15(3,4)5/h10,12-14,17H,11H2,1-9H3 |
| InChIKey | VKVXZRSCKCBRJL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|