C21H36O3Si — CID 14894503
(E)-5-[tert-butyl(dimethyl)silyl]oxy-5-ethoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol (PubChem CID 14894503) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-5-ethoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-5-ethoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol |
|---|---|
| PubChem CID | 14894503 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-5-ethoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol |
| SMILES | CCOC(O[Si](C)(C)C(C)(C)C)C(C)(C)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H36O3Si/c1-9-23-19(24-25(7,8)20(2,3)4)21(5,6)18(22)16-15-17-13-11-10-12-14-17/h10-16,18-19,22H,9H2,1-8H3/b16-15+ |
| InChIKey | AGACRSKJNKKQAL-FOCLMDBBSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|