C18H27Cl3OSi — CID 10916217
tert-butyl-dimethyl-[(E,2S)-1,1,1-trichloro-4-(4-ethylphenyl)but-3-en-2-yl]oxysilane (PubChem CID 10916217) has the molecular formula C18H27Cl3OSi and a molecular weight of 393.86 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-1,1,1-trichloro-4-(4-ethylphenyl)but-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-1,1,1-trichloro-4-(4-ethylphenyl)but-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 10916217 |
| Molecular Formula | C18H27Cl3OSi |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-1,1,1-trichloro-4-(4-ethylphenyl)but-3-en-2-yl]oxysilane |
| SMILES | CCc1ccc(/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H27Cl3OSi/c1-7-14-8-10-15(11-9-14)12-13-16(18(19,20)21)22-23(5,6)17(2,3)4/h8-13,16H,7H2,1-6H3/b13-12+/t16-/m0/s1 |
| InChIKey | VLCAHMMVQMYLQZ-DBTPVHCXSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|