C16H23F3OSi — CID 10980030
tert-butyl-dimethyl-[(E,2S)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane (PubChem CID 10980030) has the molecular formula C16H23F3OSi and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 10980030 |
| Molecular Formula | C16H23F3OSi |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H23F3OSi/c1-15(2,3)21(4,5)20-14(16(17,18)19)12-11-13-9-7-6-8-10-13/h6-12,14H,1-5H3/b12-11+/t14-/m0/s1 |
| InChIKey | MLJRPGRXPGOLON-GETOMWPZSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|