C22H26F2OSi — CID 100950780
[(1E,5E)-3,3-difluoro-6-phenyl-4-phenylmethoxyhexa-1,5-dienyl]-trimethylsilane (PubChem CID 100950780) has the molecular formula C22H26F2OSi and a molecular weight of 372.53 g/mol. Its IUPAC name is [(1E,5E)-3,3-difluoro-6-phenyl-4-phenylmethoxyhexa-1,5-dienyl]-trimethylsilane.
| Compound Name | [(1E,5E)-3,3-difluoro-6-phenyl-4-phenylmethoxyhexa-1,5-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 100950780 |
| Molecular Formula | C22H26F2OSi |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(1E,5E)-3,3-difluoro-6-phenyl-4-phenylmethoxyhexa-1,5-dienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/C(F)(F)C(/C=C/c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H26F2OSi/c1-26(2,3)17-16-22(23,24)21(15-14-19-10-6-4-7-11-19)25-18-20-12-8-5-9-13-20/h4-17,21H,18H2,1-3H3/b15-14+,17-16+ |
| InChIKey | QEMAGVOUSUESKO-JLXBFWJWSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|