C29H36OSi — CID 132576559
methyl-diphenyl-[(E,3R,4S)-3,5,5-trimethyl-4-phenylmethoxyhex-1-enyl]silane (PubChem CID 132576559) has the molecular formula C29H36OSi and a molecular weight of 428.69 g/mol. Its IUPAC name is methyl-diphenyl-[(E,3R,4S)-3,5,5-trimethyl-4-phenylmethoxyhex-1-enyl]silane.
| Compound Name | methyl-diphenyl-[(E,3R,4S)-3,5,5-trimethyl-4-phenylmethoxyhex-1-enyl]silane |
|---|---|
| PubChem CID | 132576559 |
| Molecular Formula | C29H36OSi |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | methyl-diphenyl-[(E,3R,4S)-3,5,5-trimethyl-4-phenylmethoxyhex-1-enyl]silane |
| SMILES | C[C@H](/C=C/[Si](C)(c1ccccc1)c1ccccc1)[C@H](OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36OSi/c1-24(28(29(2,3)4)30-23-25-15-9-6-10-16-25)21-22-31(5,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-22,24,28H,23H2,1-5H3/b22-21+/t24-,28+/m1/s1 |
| InChIKey | SAIHROCEKNVENH-FOSSNDPFSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|