C20H34O3Si — CID 173350668
2-dimethylsilyloxy-2,4,6,6-tetramethyl-3-phenylmethoxyheptanal (PubChem CID 173350668) has the molecular formula C20H34O3Si and a molecular weight of 350.57 g/mol. Its IUPAC name is 2-dimethylsilyloxy-2,4,6,6-tetramethyl-3-phenylmethoxyheptanal.
| Compound Name | 2-dimethylsilyloxy-2,4,6,6-tetramethyl-3-phenylmethoxyheptanal |
|---|---|
| PubChem CID | 173350668 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-dimethylsilyloxy-2,4,6,6-tetramethyl-3-phenylmethoxyheptanal |
| SMILES | CC(CC(C)(C)C)C(OCc1ccccc1)C(C)(C=O)O[SiH](C)C |
| InChI | InChI=1S/C20H34O3Si/c1-16(13-19(2,3)4)18(20(5,15-21)23-24(6)7)22-14-17-11-9-8-10-12-17/h8-12,15-16,18,24H,13-14H2,1-7H3 |
| InChIKey | GXBOKJKSNLRHNP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|