C31H31NO3Si — CID 132576556
methyl-[(E,3R,4S)-3-methyl-4-(2-nitrophenyl)-4-phenylmethoxybut-1-enyl]-diphenylsilane (PubChem CID 132576556) has the molecular formula C31H31NO3Si and a molecular weight of 493.68 g/mol. Its IUPAC name is methyl-[(E,3R,4S)-3-methyl-4-(2-nitrophenyl)-4-phenylmethoxybut-1-enyl]-diphenylsilane.
| Compound Name | methyl-[(E,3R,4S)-3-methyl-4-(2-nitrophenyl)-4-phenylmethoxybut-1-enyl]-diphenylsilane |
|---|---|
| PubChem CID | 132576556 |
| Molecular Formula | C31H31NO3Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | methyl-[(E,3R,4S)-3-methyl-4-(2-nitrophenyl)-4-phenylmethoxybut-1-enyl]-diphenylsilane |
| SMILES | C[C@H](/C=C/[Si](C)(c1ccccc1)c1ccccc1)[C@H](OCc1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H31NO3Si/c1-25(22-23-36(2,27-16-8-4-9-17-27)28-18-10-5-11-19-28)31(35-24-26-14-6-3-7-15-26)29-20-12-13-21-30(29)32(33)34/h3-23,25,31H,24H2,1-2H3/b23-22+/t25-,31+/m1/s1 |
| InChIKey | QWNYKUYAZWQQDT-NALUKKQNSA-N |
| XLogP | 6.48 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|