C25H29NO9 — CID 10390739
methyl (E,2R,5S,6R)-2-acetyloxy-6-(2,5-dimethoxy-3-nitrophenyl)-5-methyl-6-phenylmethoxyhex-3-enoate (PubChem CID 10390739) has the molecular formula C25H29NO9 and a molecular weight of 487.51 g/mol. Its IUPAC name is methyl (E,2R,5S,6R)-2-acetyloxy-6-(2,5-dimethoxy-3-nitrophenyl)-5-methyl-6-phenylmethoxyhex-3-enoate.
| Compound Name | methyl (E,2R,5S,6R)-2-acetyloxy-6-(2,5-dimethoxy-3-nitrophenyl)-5-methyl-6-phenylmethoxyhex-3-enoate |
|---|---|
| PubChem CID | 10390739 |
| Molecular Formula | C25H29NO9 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | methyl (E,2R,5S,6R)-2-acetyloxy-6-(2,5-dimethoxy-3-nitrophenyl)-5-methyl-6-phenylmethoxyhex-3-enoate |
| SMILES | COC(=O)[C@@H](/C=C/[C@H](C)[C@@H](OCc1ccccc1)c1cc(OC)cc([N+](=O)[O-])c1OC)OC(C)=O |
| InChI | InChI=1S/C25H29NO9/c1-16(11-12-22(25(28)33-5)35-17(2)27)23(34-15-18-9-7-6-8-10-18)20-13-19(31-3)14-21(26(29)30)24(20)32-4/h6-14,16,22-23H,15H2,1-5H3/b12-11+/t16-,22+,23+/m0/s1 |
| InChIKey | MTLIIKNMJJWTBZ-MDRWHSKUSA-N |
| XLogP | 4.17 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|