C17H23NO7 — CID 50993243
(E,4S,5R)-5-(2,5-dimethoxy-3-nitrophenyl)-5-(methoxymethoxy)-2,4-dimethylpent-2-enal (PubChem CID 50993243) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is (E,4S,5R)-5-(2,5-dimethoxy-3-nitrophenyl)-5-(methoxymethoxy)-2,4-dimethylpent-2-enal.
| Compound Name | (E,4S,5R)-5-(2,5-dimethoxy-3-nitrophenyl)-5-(methoxymethoxy)-2,4-dimethylpent-2-enal |
|---|---|
| PubChem CID | 50993243 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (E,4S,5R)-5-(2,5-dimethoxy-3-nitrophenyl)-5-(methoxymethoxy)-2,4-dimethylpent-2-enal |
| SMILES | COCO[C@@H](c1cc(OC)cc([N+](=O)[O-])c1OC)[C@@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C17H23NO7/c1-11(9-19)6-12(2)16(25-10-22-3)14-7-13(23-4)8-15(18(20)21)17(14)24-5/h6-9,12,16H,10H2,1-5H3/b11-6+/t12-,16+/m0/s1 |
| InChIKey | GKGXNHOCZZMXRY-OVIKPHDNSA-N |
| XLogP | 3.05 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|