C9H11N3O6 — CID 87512299
N-ethyl-N-(4-methoxy-2,6-dinitrophenyl)hydroxylamine (PubChem CID 87512299) has the molecular formula C9H11N3O6 and a molecular weight of 257.20 g/mol. Its IUPAC name is N-ethyl-N-(4-methoxy-2,6-dinitrophenyl)hydroxylamine.
| Compound Name | N-ethyl-N-(4-methoxy-2,6-dinitrophenyl)hydroxylamine |
|---|---|
| PubChem CID | 87512299 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-ethyl-N-(4-methoxy-2,6-dinitrophenyl)hydroxylamine |
| SMILES | CCN(O)c1c([N+](=O)[O-])cc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O6/c1-3-10(13)9-7(11(14)15)4-6(18-2)5-8(9)12(16)17/h4-5,13H,3H2,1-2H3 |
| InChIKey | GYMVNAZDCWELQY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|