C14H16N4O8 — CID 159513130
2,6-diamino-4-methoxyphenol;4-methoxy-2,6-dinitrophenol (PubChem CID 159513130) has the molecular formula C14H16N4O8 and a molecular weight of 368.30 g/mol. Its IUPAC name is 2,6-diamino-4-methoxyphenol;4-methoxy-2,6-dinitrophenol.
| Compound Name | 2,6-diamino-4-methoxyphenol;4-methoxy-2,6-dinitrophenol |
|---|---|
| PubChem CID | 159513130 |
| Molecular Formula | C14H16N4O8 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2,6-diamino-4-methoxyphenol;4-methoxy-2,6-dinitrophenol |
| SMILES | COc1cc(N)c(O)c(N)c1.COc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O6.C7H10N2O2/c1-15-4-2-5(8(11)12)7(10)6(3-4)9(13)14;1-11-4-2-5(8)7(10)6(9)3-4/h2-3,10H,1H3;2-3,10H,8-9H2,1H3 |
| InChIKey | MAVWBKCEGGXGTL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 197.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|