C14H11N3O9 — CID 169405883
2-amino-4-(2-hydroxy-5-methoxy-3-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405883) has the molecular formula C14H11N3O9 and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-amino-4-(2-hydroxy-5-methoxy-3-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2-hydroxy-5-methoxy-3-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405883 |
| Molecular Formula | C14H11N3O9 |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-amino-4-(2-hydroxy-5-methoxy-3-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O9/c1-26-4-2-5(10(18)6(3-4)17(24)25)7-8(13(20)21)11(15)16-12(19)9(7)14(22)23/h2-3,18H,1H3,(H,20,21)(H,22,23)(H3,15,16,19) |
| InChIKey | XKDWYZGRSJHHFW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 206.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|