C14H10BrN3O8 — CID 169405925
2-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405925) has the molecular formula C14H10BrN3O8 and a molecular weight of 428.15 g/mol. Its IUPAC name is 2-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405925 |
| Molecular Formula | C14H10BrN3O8 |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 2-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Cc1c([N+](=O)[O-])cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c(O)c1Br |
| InChI | InChI=1S/C14H10BrN3O8/c1-3-5(18(25)26)2-4(10(19)9(3)15)6-7(13(21)22)11(16)17-12(20)8(6)14(23)24/h2,19H,1H3,(H,21,22)(H,23,24)(H3,16,17,20) |
| InChIKey | STVTYXKHUKUYEC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 196.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|