C15H12BrN3O8 — CID 169405947
2-amino-4-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405947) has the molecular formula C15H12BrN3O8 and a molecular weight of 442.18 g/mol. Its IUPAC name is 2-amino-4-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405947 |
| Molecular Formula | C15H12BrN3O8 |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2-amino-4-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Cc1c(Br)c(O)c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12BrN3O8/c1-3-5(11(20)9(16)4(2)10(3)19(26)27)6-7(14(22)23)12(17)18-13(21)8(6)15(24)25/h20H,1-2H3,(H,22,23)(H,24,25)(H3,17,18,21) |
| InChIKey | BMGRCSFRYZSDJG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 196.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|