C13H9N3O9 — CID 169406889
2-amino-4-(2,4-dihydroxy-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406889) has the molecular formula C13H9N3O9 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-amino-4-(2,4-dihydroxy-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2,4-dihydroxy-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406889 |
| Molecular Formula | C13H9N3O9 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-amino-4-(2,4-dihydroxy-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cc([N+](=O)[O-])c(O)cc2O)c1C(=O)O |
| InChI | InChI=1S/C13H9N3O9/c14-10-8(12(20)21)7(9(13(22)23)11(19)15-10)3-1-4(16(24)25)6(18)2-5(3)17/h1-2,17-18H,(H,20,21)(H,22,23)(H3,14,15,19) |
| InChIKey | GWEMYMUTCSGWJK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 217.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|