C20H15N3O8 — CID 169407588
2-amino-4-(3-nitro-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407588) has the molecular formula C20H15N3O8 and a molecular weight of 425.35 g/mol. Its IUPAC name is 2-amino-4-(3-nitro-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3-nitro-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407588 |
| Molecular Formula | C20H15N3O8 |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-amino-4-(3-nitro-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)c1C(=O)O |
| InChI | InChI=1S/C20H15N3O8/c21-17-15(19(25)26)14(16(20(27)28)18(24)22-17)11-6-7-13(12(8-11)23(29)30)31-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,25,26)(H,27,28)(H3,21,22,24) |
| InChIKey | LVKBAKIQYOEYOC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 185.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|