C22H19N3O9 — CID 169407313
2-amino-4-[3-methoxy-4-[(4-methyl-2-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407313) has the molecular formula C22H19N3O9 and a molecular weight of 469.41 g/mol. Its IUPAC name is 2-amino-4-[3-methoxy-4-[(4-methyl-2-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[3-methoxy-4-[(4-methyl-2-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407313 |
| Molecular Formula | C22H19N3O9 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-amino-4-[3-methoxy-4-[(4-methyl-2-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)ccc1OCc1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O9/c1-10-3-4-12(13(7-10)25(31)32)9-34-14-6-5-11(8-15(14)33-2)16-17(21(27)28)19(23)24-20(26)18(16)22(29)30/h3-8H,9H2,1-2H3,(H,27,28)(H,29,30)(H3,23,24,26) |
| InChIKey | TVIOZUSLLSXGQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|