C15H13N3O9 — CID 169405937
2-amino-4-(2,3-dimethoxy-6-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405937) has the molecular formula C15H13N3O9 and a molecular weight of 379.28 g/mol. Its IUPAC name is 2-amino-4-(2,3-dimethoxy-6-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2,3-dimethoxy-6-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405937 |
| Molecular Formula | C15H13N3O9 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-amino-4-(2,3-dimethoxy-6-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1OC |
| InChI | InChI=1S/C15H13N3O9/c1-26-6-4-3-5(18(24)25)7(11(6)27-2)8-9(14(20)21)12(16)17-13(19)10(8)15(22)23/h3-4H,1-2H3,(H,20,21)(H,22,23)(H3,16,17,19) |
| InChIKey | YMDKLABPYIBYAS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|