C15H13N3O8 — CID 169405949
2-amino-4-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405949) has the molecular formula C15H13N3O8 and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-amino-4-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405949 |
| Molecular Formula | C15H13N3O8 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-amino-4-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1O |
| InChI | InChI=1S/C15H13N3O8/c1-4-3-6(18(25)26)5(2)7(11(4)19)8-9(14(21)22)12(16)17-13(20)10(8)15(23)24/h3,19H,1-2H3,(H,21,22)(H,23,24)(H3,16,17,20) |
| InChIKey | LUJUYHLVCCTGSJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 196.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|