C16H13N3O11 — CID 169406508
2-amino-4-[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406508) has the molecular formula C16H13N3O11 and a molecular weight of 423.29 g/mol. Its IUPAC name is 2-amino-4-[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406508 |
| Molecular Formula | C16H13N3O11 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-amino-4-[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1OCC(=O)O |
| InChI | InChI=1S/C16H13N3O11/c1-29-7-3-5(19(27)28)2-6(12(7)30-4-8(20)21)9-10(15(23)24)13(17)18-14(22)11(9)16(25)26/h2-3H,4H2,1H3,(H,20,21)(H,23,24)(H,25,26)(H3,17,18,22) |
| InChIKey | CUKABZAEORVDMN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 232.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|