C16H13N3O10 — CID 169406878
2-amino-4-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406878) has the molecular formula C16H13N3O10 and a molecular weight of 407.29 g/mol. Its IUPAC name is 2-amino-4-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406878 |
| Molecular Formula | C16H13N3O10 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-amino-4-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COC(=O)COc1ccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O10/c1-28-9(20)5-29-8-3-2-6(4-7(8)19(26)27)10-11(15(22)23)13(17)18-14(21)12(10)16(24)25/h2-4H,5H2,1H3,(H,22,23)(H,24,25)(H3,17,18,21) |
| InChIKey | LTEAJBBTRHMDGN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 212.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|