C21H15N3O10 — CID 169407722
2-amino-4-[2-(2-methoxycarbonyl-4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407722) has the molecular formula C21H15N3O10 and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-amino-4-[2-(2-methoxycarbonyl-4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-(2-methoxycarbonyl-4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407722 |
| Molecular Formula | C21H15N3O10 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-amino-4-[2-(2-methoxycarbonyl-4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1Oc1ccccc1-c1c(C(=O)O)c(N)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C21H15N3O10/c1-33-21(30)11-8-9(24(31)32)6-7-13(11)34-12-5-3-2-4-10(12)14-15(19(26)27)17(22)23-18(25)16(14)20(28)29/h2-8H,1H3,(H,26,27)(H,28,29)(H3,22,23,25) |
| InChIKey | AYEHZQHYXYWKBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 212.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|