C16H11N5O7 — CID 169394528
2-[2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-6-methoxy-4-nitrophenoxy]acetic acid (PubChem CID 169394528) has the molecular formula C16H11N5O7 and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-[2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-6-methoxy-4-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-6-methoxy-4-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 169394528 |
| Molecular Formula | C16H11N5O7 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-6-methoxy-4-nitrophenoxy]acetic acid |
| SMILES | COc1cc([N+](=O)[O-])cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c1OCC(=O)O |
| InChI | InChI=1S/C16H11N5O7/c1-27-11-3-7(21(25)26)2-8(14(11)28-6-12(22)23)13-9(4-17)15(19)20-16(24)10(13)5-18/h2-3H,6H2,1H3,(H,22,23)(H3,19,20,24) |
| InChIKey | KLOYNUCIOUWNQD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 205.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|