C14H9N5O3 — CID 169393298
2-amino-4-(2-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393298) has the molecular formula C14H9N5O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-amino-4-(2-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393298 |
| Molecular Formula | C14H9N5O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-amino-4-(2-methyl-5-nitrophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C14H9N5O3/c1-7-2-3-8(19(21)22)4-9(7)12-10(5-15)13(17)18-14(20)11(12)6-16/h2-4H,1H3,(H3,17,18,20) |
| InChIKey | FNRPPLLLKHCOOS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|