C15H13BN4O3 — CID 169394273
[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-3-ethylphenyl]boronic acid (PubChem CID 169394273) has the molecular formula C15H13BN4O3 and a molecular weight of 308.11 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-3-ethylphenyl]boronic acid.
| Compound Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-3-ethylphenyl]boronic acid |
|---|---|
| PubChem CID | 169394273 |
| Molecular Formula | C15H13BN4O3 |
| Molecular Weight | 308.11 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-3-ethylphenyl]boronic acid |
| SMILES | CCc1cc(B(O)O)ccc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C15H13BN4O3/c1-2-8-5-9(16(22)23)3-4-10(8)13-11(6-17)14(19)20-15(21)12(13)7-18/h3-5,22-23H,2H2,1H3,(H3,19,20,21) |
| InChIKey | OYTJXYVOUULSMH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.11 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|