C21H14F4N2O7 — CID 169405849
2-amino-4-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405849) has the molecular formula C21H14F4N2O7 and a molecular weight of 482.34 g/mol. Its IUPAC name is 2-amino-4-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405849 |
| Molecular Formula | C21H14F4N2O7 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-amino-4-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H14F4N2O7/c1-33-11-3-2-7(12-13(20(29)30)18(26)27-19(28)14(12)21(31)32)4-8(11)6-34-17-15(24)9(22)5-10(23)16(17)25/h2-5H,6H2,1H3,(H,29,30)(H,31,32)(H3,26,27,28) |
| InChIKey | XEHLWUXPONFAHP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|