C14H8F3N3O7 — CID 169407835
2-amino-4-[2-nitro-3-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407835) has the molecular formula C14H8F3N3O7 and a molecular weight of 387.23 g/mol. Its IUPAC name is 2-amino-4-[2-nitro-3-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-nitro-3-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407835 |
| Molecular Formula | C14H8F3N3O7 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-amino-4-[2-nitro-3-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cccc(C(F)(F)F)c2[N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C14H8F3N3O7/c15-14(16,17)5-3-1-2-4(9(5)20(26)27)6-7(12(22)23)10(18)19-11(21)8(6)13(24)25/h1-3H,(H,22,23)(H,24,25)(H3,18,19,21) |
| InChIKey | TWPUWDZPEZBLMH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|