C11H15N3O5 — CID 21329883
N,4-diethyl-N-methoxy-2,6-dinitroaniline (PubChem CID 21329883) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is N,4-diethyl-N-methoxy-2,6-dinitroaniline.
| Compound Name | N,4-diethyl-N-methoxy-2,6-dinitroaniline |
|---|---|
| PubChem CID | 21329883 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N,4-diethyl-N-methoxy-2,6-dinitroaniline |
| SMILES | CCc1cc([N+](=O)[O-])c(N(CC)OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O5/c1-4-8-6-9(13(15)16)11(12(5-2)19-3)10(7-8)14(17)18/h6-7H,4-5H2,1-3H3 |
| InChIKey | WZLORQYYVJMKFB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|