C11H10F3N3O5 — CID 54242312
N-methoxy-2,6-dinitro-N-prop-2-enyl-4-(trifluoromethyl)aniline (PubChem CID 54242312) has the molecular formula C11H10F3N3O5 and a molecular weight of 321.21 g/mol. Its IUPAC name is N-methoxy-2,6-dinitro-N-prop-2-enyl-4-(trifluoromethyl)aniline.
| Compound Name | N-methoxy-2,6-dinitro-N-prop-2-enyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 54242312 |
| Molecular Formula | C11H10F3N3O5 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-methoxy-2,6-dinitro-N-prop-2-enyl-4-(trifluoromethyl)aniline |
| SMILES | C=CCN(OC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F3N3O5/c1-3-4-15(22-2)10-8(16(18)19)5-7(11(12,13)14)6-9(10)17(20)21/h3,5-6H,1,4H2,2H3 |
| InChIKey | QQWFHXVNFZGCEM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|