C10H5F6N2O4- — CID 88820291
N-methyl-N-[2-nitro-4,6-bis(trifluoromethyl)phenyl]carbamate (PubChem CID 88820291) has the molecular formula C10H5F6N2O4- and a molecular weight of 331.15 g/mol. Its IUPAC name is N-methyl-N-[2-nitro-4,6-bis(trifluoromethyl)phenyl]carbamate.
| Compound Name | N-methyl-N-[2-nitro-4,6-bis(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 88820291 |
| Molecular Formula | C10H5F6N2O4- |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-methyl-N-[2-nitro-4,6-bis(trifluoromethyl)phenyl]carbamate |
| SMILES | CN(C(=O)[O-])c1c([N+](=O)[O-])cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6N2O4/c1-17(8(19)20)7-5(10(14,15)16)2-4(9(11,12)13)3-6(7)18(21)22/h2-3H,1H3,(H,19,20)/p-1 |
| InChIKey | ROIFOYDRAMOOSB-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|