C12H13F3N2O3 — CID 12896998
N,2-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 12896998) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N,2-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N,2-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 12896998 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N,2-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)C(=O)N(C)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-7(2)11(18)16(3)8-4-5-10(17(19)20)9(6-8)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | BDQDENLWTJFKNB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|