C16H19F3N2O4 — CID 154212904
[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl] acetate (PubChem CID 154212904) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is [4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl] acetate.
| Compound Name | [4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 154212904 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl] acetate |
| SMILES | CC(=O)OC1CCC(N(C)c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3N2O4/c1-10(22)25-13-6-3-11(4-7-13)20(2)12-5-8-15(21(23)24)14(9-12)16(17,18)19/h5,8-9,11,13H,3-4,6-7H2,1-2H3 |
| InChIKey | FWWMMXAHUPKQAC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|