C30H36F4N4O5 — CID 90163098
1-[4-[1-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90163098) has the molecular formula C30H36F4N4O5 and a molecular weight of 608.63 g/mol. Its IUPAC name is 1-[4-[1-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[1-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90163098 |
| Molecular Formula | C30H36F4N4O5 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 1-[4-[1-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | CC(C1Cc2cc(F)ccc2O1)N1CCN(C(=O)COC2CCC(N(C)c3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H36F4N4O5/c1-19(28-16-20-15-21(31)3-10-27(20)43-28)36-11-13-37(14-12-36)29(39)18-42-24-7-4-22(5-8-24)35(2)23-6-9-26(38(40)41)25(17-23)30(32,33)34/h3,6,9-10,15,17,19,22,24,28H,4-5,7-8,11-14,16,18H2,1-2H3 |
| InChIKey | QQDOQIHFPKQOOH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|