C31H36ClF3N4O5 — CID 90163099
1-[4-[1-(3-chloro-5-methyl-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90163099) has the molecular formula C31H36ClF3N4O5 and a molecular weight of 637.10 g/mol. Its IUPAC name is 1-[4-[1-(3-chloro-5-methyl-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[1-(3-chloro-5-methyl-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90163099 |
| Molecular Formula | C31H36ClF3N4O5 |
| Molecular Weight | 637.10 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 1-[4-[1-(3-chloro-5-methyl-1-benzofuran-2-yl)ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | Cc1ccc2oc(C(C)N3CCN(C(=O)COC4CCC(N(C)c5ccc([N+](=O)[O-])c(C(F)(F)F)c5)CC4)CC3)c(Cl)c2c1 |
| InChI | InChI=1S/C31H36ClF3N4O5/c1-19-4-11-27-24(16-19)29(32)30(44-27)20(2)37-12-14-38(15-13-37)28(40)18-43-23-8-5-21(6-9-23)36(3)22-7-10-26(39(41)42)25(17-22)31(33,34)35/h4,7,10-11,16-17,20-21,23H,5-6,8-9,12-15,18H2,1-3H3 |
| InChIKey | RVPRBJUSKWDTRK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.10 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|