C29H25F3N4O6 — CID 90163086
1-[4-(5-methyl-1-benzofuran-2-carbonyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]ethanone (PubChem CID 90163086) has the molecular formula C29H25F3N4O6 and a molecular weight of 582.54 g/mol. Its IUPAC name is 1-[4-(5-methyl-1-benzofuran-2-carbonyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]ethanone.
| Compound Name | 1-[4-(5-methyl-1-benzofuran-2-carbonyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]ethanone |
|---|---|
| PubChem CID | 90163086 |
| Molecular Formula | C29H25F3N4O6 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 1-[4-(5-methyl-1-benzofuran-2-carbonyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]ethanone |
| SMILES | Cc1ccc2oc(C(=O)N3CCN(C(=O)COc4ccc(Nc5ccc([N+](=O)[O-])c(C(F)(F)F)c5)cc4)CC3)cc2c1 |
| InChI | InChI=1S/C29H25F3N4O6/c1-18-2-9-25-19(14-18)15-26(42-25)28(38)35-12-10-34(11-13-35)27(37)17-41-22-6-3-20(4-7-22)33-21-5-8-24(36(39)40)23(16-21)29(30,31)32/h2-9,14-16,33H,10-13,17H2,1H3 |
| InChIKey | HSGMQNFLXJZOPZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|