C27H20F4N4O6 — CID 137404515
4-(5-fluoro-1-benzofuran-2-carbonyl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenyl]piperazine-1-carboxylic acid (PubChem CID 137404515) has the molecular formula C27H20F4N4O6 and a molecular weight of 572.47 g/mol. Its IUPAC name is 4-(5-fluoro-1-benzofuran-2-carbonyl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-(5-fluoro-1-benzofuran-2-carbonyl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 137404515 |
| Molecular Formula | C27H20F4N4O6 |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 4-(5-fluoro-1-benzofuran-2-carbonyl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]phenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(c1cc2cc(F)ccc2o1)N1CCN(C(=O)O)C(c2ccc(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C27H20F4N4O6/c28-17-3-8-23-16(11-17)12-24(41-23)25(36)33-9-10-34(26(37)38)22(14-33)15-1-4-18(5-2-15)32-19-6-7-21(35(39)40)20(13-19)27(29,30)31/h1-8,11-13,22,32H,9-10,14H2,(H,37,38) |
| InChIKey | DQOJNZQWWCPAIH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|