C27H20F6N4O6 — CID 90150743
N'-[3-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]propyl]oxamide (PubChem CID 90150743) has the molecular formula C27H20F6N4O6 and a molecular weight of 610.47 g/mol. Its IUPAC name is N'-[3-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]propyl]oxamide.
| Compound Name | N'-[3-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]propyl]oxamide |
|---|---|
| PubChem CID | 90150743 |
| Molecular Formula | C27H20F6N4O6 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | N'-[3-[4-[4-nitro-3-(trifluoromethyl)anilino]phenoxy]-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]propyl]oxamide |
| SMILES | NC(=O)C(=O)NC(CCOc1ccc(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1)c1cc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C27H20F6N4O6/c28-26(29,30)15-1-8-22-14(11-15)12-23(43-22)20(36-25(39)24(34)38)9-10-42-18-5-2-16(3-6-18)35-17-4-7-21(37(40)41)19(13-17)27(31,32)33/h1-8,11-13,20,35H,9-10H2,(H2,34,38)(H,36,39) |
| InChIKey | YWGDWEYUVWEWSP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|