C17H11ClF3N3O4 — CID 143036876
3-(3-chloro-4-cyanophenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 143036876) has the molecular formula C17H11ClF3N3O4 and a molecular weight of 413.74 g/mol. Its IUPAC name is 3-(3-chloro-4-cyanophenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(3-chloro-4-cyanophenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 143036876 |
| Molecular Formula | C17H11ClF3N3O4 |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-(3-chloro-4-cyanophenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | N#Cc1ccc(OCCC(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C17H11ClF3N3O4/c18-14-8-12(3-1-10(14)9-22)28-6-5-16(25)23-11-2-4-15(24(26)27)13(7-11)17(19,20)21/h1-4,7-8H,5-6H2,(H,23,25) |
| InChIKey | STTDAYGNRRMCNT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|