C12H9F3O4 — CID 115072049
methyl 2-hydroxy-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]acetate (PubChem CID 115072049) has the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]acetate.
| Compound Name | methyl 2-hydroxy-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]acetate |
|---|---|
| PubChem CID | 115072049 |
| Molecular Formula | C12H9F3O4 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 2-hydroxy-2-[5-(trifluoromethyl)-1-benzofuran-2-yl]acetate |
| SMILES | COC(=O)C(O)c1cc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C12H9F3O4/c1-18-11(17)10(16)9-5-6-4-7(12(13,14)15)2-3-8(6)19-9/h2-5,10,16H,1H3 |
| InChIKey | MIWMNUGFWFYBKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |