C14H15F3N2O2 — CID 115072109
methyl 2-amino-2-[1-ethyl-5-(trifluoromethyl)indol-2-yl]acetate (PubChem CID 115072109) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is methyl 2-amino-2-[1-ethyl-5-(trifluoromethyl)indol-2-yl]acetate.
| Compound Name | methyl 2-amino-2-[1-ethyl-5-(trifluoromethyl)indol-2-yl]acetate |
|---|---|
| PubChem CID | 115072109 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 2-amino-2-[1-ethyl-5-(trifluoromethyl)indol-2-yl]acetate |
| SMILES | CCn1c(C(N)C(=O)OC)cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H15F3N2O2/c1-3-19-10-5-4-9(14(15,16)17)6-8(10)7-11(19)12(18)13(20)21-2/h4-7,12H,3,18H2,1-2H3 |
| InChIKey | MHWFVUYPAUQJMF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |