C15H18F3NO2S — CID 135377990
2-methyl-N-[(1R)-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]propane-2-sulfinamide (PubChem CID 135377990) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(1R)-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 135377990 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-methyl-N-[(1R)-1-[5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]propane-2-sulfinamide |
| SMILES | C[C@@H](NS(=O)C(C)(C)C)c1cc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C15H18F3NO2S/c1-9(19-22(20)14(2,3)4)13-8-10-7-11(15(16,17)18)5-6-12(10)21-13/h5-9,19H,1-4H3/t9-,22?/m1/s1 |
| InChIKey | NTUSSMWQAOBUOZ-FKRFUDFQSA-N |
| XLogP | 4.56 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |