C13H17F4NOS — CID 118492083
(S)-N-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 118492083) has the molecular formula C13H17F4NOS and a molecular weight of 311.34 g/mol. Its IUPAC name is (S)-N-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118492083 |
| Molecular Formula | C13H17F4NOS |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (S)-N-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](N[S@@](=O)C(C)(C)C)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F4NOS/c1-8(18-20(19)12(2,3)4)9-5-10(13(15,16)17)7-11(14)6-9/h5-8,18H,1-4H3/t8-,20-/m0/s1 |
| InChIKey | OEPPSOJGNBSQFB-FHZGZLOMSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |