C10H11F4N — CID 118492024
(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylethanamine (PubChem CID 118492024) has the molecular formula C10H11F4N and a molecular weight of 221.20 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylethanamine.
| Compound Name | (1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 118492024 |
| Molecular Formula | C10H11F4N |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylethanamine |
| SMILES | CN[C@@H](C)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F4N/c1-6(15-2)7-3-8(10(12,13)14)5-9(11)4-7/h3-6,15H,1-2H3/t6-/m0/s1 |
| InChIKey | NTRRXIADOHPEOK-LURJTMIESA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |