C9H9F4N — CID 18543066
1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine (PubChem CID 18543066) has the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. Its IUPAC name is 1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 18543066 |
| Molecular Formula | C9H9F4N |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(N)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F4N/c1-5(14)6-2-7(9(11,12)13)4-8(10)3-6/h2-5H,14H2,1H3 |
| InChIKey | CYBTYBCFSPUKPL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |